C14H14ClFN6O — CID 135293249
1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-[(3-chloro-4-fluorophenyl)methyl]urea (PubChem CID 135293249) has the molecular formula C14H14ClFN6O and a molecular weight of 336.76 g/mol. Its IUPAC name is 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-[(3-chloro-4-fluorophenyl)methyl]urea.
| Compound Name | 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-[(3-chloro-4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 135293249 |
| Molecular Formula | C14H14ClFN6O |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-[(3-chloro-4-fluorophenyl)methyl]urea |
| SMILES | [H]/N=C(\N)c1cnc(NC(=O)NCc2ccc(F)c(Cl)c2)cc1N |
| InChI | InChI=1S/C14H14ClFN6O/c15-9-3-7(1-2-10(9)16)5-21-14(23)22-12-4-11(17)8(6-20-12)13(18)19/h1-4,6H,5H2,(H3,18,19)(H4,17,20,21,22,23) |
| InChIKey | LPONARAZKMGXHE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|