C13H10Cl2FN3O — CID 114923313
2-amino-5-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pyridine-4-carboxamide (PubChem CID 114923313) has the molecular formula C13H10Cl2FN3O and a molecular weight of 314.15 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-amino-5-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114923313 |
| Molecular Formula | C13H10Cl2FN3O |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-amino-5-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)NCc2ccc(F)c(Cl)c2)c(Cl)cn1 |
| InChI | InChI=1S/C13H10Cl2FN3O/c14-9-3-7(1-2-11(9)16)5-19-13(20)8-4-12(17)18-6-10(8)15/h1-4,6H,5H2,(H2,17,18)(H,19,20) |
| InChIKey | RCYBLWYTIHWFTL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |