C13H10ClF3N4O — CID 166319426
N-[(6-amino-3-pyridinyl)methyl]-5-chloro-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 166319426) has the molecular formula C13H10ClF3N4O and a molecular weight of 330.70 g/mol. Its IUPAC name is N-[(6-amino-3-pyridinyl)methyl]-5-chloro-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[(6-amino-3-pyridinyl)methyl]-5-chloro-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166319426 |
| Molecular Formula | C13H10ClF3N4O |
| Molecular Weight | 330.70 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[(6-amino-3-pyridinyl)methyl]-5-chloro-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | Nc1ccc(CNC(=O)c2cc(C(F)(F)F)ncc2Cl)cn1 |
| InChI | InChI=1S/C13H10ClF3N4O/c14-9-6-19-10(13(15,16)17)3-8(9)12(22)21-5-7-1-2-11(18)20-4-7/h1-4,6H,5H2,(H2,18,20)(H,21,22) |
| InChIKey | FPDNDDPNPRIBDP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.70 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |