C20H15Cl2F3N4O2 — CID 58886296
6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyridine-3-carboxamide (PubChem CID 58886296) has the molecular formula C20H15Cl2F3N4O2 and a molecular weight of 471.27 g/mol. Its IUPAC name is 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyridine-3-carboxamide.
| Compound Name | 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58886296 |
| Molecular Formula | C20H15Cl2F3N4O2 |
| Molecular Weight | 471.27 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyridine-3-carboxamide |
| SMILES | Nc1ncc(C(=O)NCc2ccc(C(F)(F)F)nc2)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H15Cl2F3N4O2/c21-14-2-1-3-15(22)13(14)10-31-16-6-12(9-28-18(16)26)19(30)29-8-11-4-5-17(27-7-11)20(23,24)25/h1-7,9H,8,10H2,(H2,26,28)(H,29,30) |
| InChIKey | CNYMIUYDDVFABR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|