C16H16Cl2N4O3 — CID 58885815
6-amino-N-(2-amino-2-oxoethyl)-5-[(2,6-dichlorophenyl)methoxy]-N-methylpyridine-3-carboxamide (PubChem CID 58885815) has the molecular formula C16H16Cl2N4O3 and a molecular weight of 383.24 g/mol. Its IUPAC name is 6-amino-N-(2-amino-2-oxoethyl)-5-[(2,6-dichlorophenyl)methoxy]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-amino-N-(2-amino-2-oxoethyl)-5-[(2,6-dichlorophenyl)methoxy]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 58885815 |
| Molecular Formula | C16H16Cl2N4O3 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 6-amino-N-(2-amino-2-oxoethyl)-5-[(2,6-dichlorophenyl)methoxy]-N-methylpyridine-3-carboxamide |
| SMILES | CN(CC(N)=O)C(=O)c1cnc(N)c(OCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N4O3/c1-22(7-14(19)23)16(24)9-5-13(15(20)21-6-9)25-8-10-11(17)3-2-4-12(10)18/h2-6H,7-8H2,1H3,(H2,19,23)(H2,20,21) |
| InChIKey | NVHMCSJYWWENQG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|