C19H22Cl2N4O3 — CID 58885848
6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide (PubChem CID 58885848) has the molecular formula C19H22Cl2N4O3 and a molecular weight of 425.32 g/mol. Its IUPAC name is 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide.
| Compound Name | 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58885848 |
| Molecular Formula | C19H22Cl2N4O3 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 6-amino-5-[(2,6-dichlorophenyl)methoxy]-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide |
| SMILES | Nc1ncc(C(=O)NCCN2CCOCC2)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H22Cl2N4O3/c20-15-2-1-3-16(21)14(15)12-28-17-10-13(11-24-18(17)22)19(26)23-4-5-25-6-8-27-9-7-25/h1-3,10-11H,4-9,12H2,(H2,22,24)(H,23,26) |
| InChIKey | ANKSUGUVVZKVFB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|