C26H27F3N4O3 — CID 21111284
4-[6-amino-5-[[2-(trifluoromethyl)phenyl]methoxy]-3-pyridinyl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 21111284) has the molecular formula C26H27F3N4O3 and a molecular weight of 500.52 g/mol. Its IUPAC name is 4-[6-amino-5-[[2-(trifluoromethyl)phenyl]methoxy]-3-pyridinyl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-[6-amino-5-[[2-(trifluoromethyl)phenyl]methoxy]-3-pyridinyl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 21111284 |
| Molecular Formula | C26H27F3N4O3 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-[6-amino-5-[[2-(trifluoromethyl)phenyl]methoxy]-3-pyridinyl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | Nc1ncc(-c2ccc(C(=O)NCCN3CCOCC3)cc2)cc1OCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H27F3N4O3/c27-26(28,29)22-4-2-1-3-20(22)17-36-23-15-21(16-32-24(23)30)18-5-7-19(8-6-18)25(34)31-9-10-33-11-13-35-14-12-33/h1-8,15-16H,9-14,17H2,(H2,30,32)(H,31,34) |
| InChIKey | DDSUSRVLXHSUQR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|