C24H29Cl2N5O3 — CID 58886146
2-[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]pyridine-3-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 58886146) has the molecular formula C24H29Cl2N5O3 and a molecular weight of 506.43 g/mol. Its IUPAC name is 2-[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]pyridine-3-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]pyridine-3-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 58886146 |
| Molecular Formula | C24H29Cl2N5O3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]pyridine-3-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | Nc1ncc(C(=O)N2CCN(CC(=O)N3CCCCC3)CC2)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H29Cl2N5O3/c25-19-5-4-6-20(26)18(19)16-34-21-13-17(14-28-23(21)27)24(33)31-11-9-29(10-12-31)15-22(32)30-7-2-1-3-8-30/h4-6,13-14H,1-3,7-12,15-16H2,(H2,27,28) |
| InChIKey | OKDGBUQIUIOARU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|