C16H14Cl2N4O2 — CID 58886213
6-amino-N-(cyanomethyl)-5-[(2,6-dichlorophenyl)methoxy]-N-methylpyridine-3-carboxamide (PubChem CID 58886213) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 6-amino-N-(cyanomethyl)-5-[(2,6-dichlorophenyl)methoxy]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-amino-N-(cyanomethyl)-5-[(2,6-dichlorophenyl)methoxy]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 58886213 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 6-amino-N-(cyanomethyl)-5-[(2,6-dichlorophenyl)methoxy]-N-methylpyridine-3-carboxamide |
| SMILES | CN(CC#N)C(=O)c1cnc(N)c(OCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N4O2/c1-22(6-5-19)16(23)10-7-14(15(20)21-8-10)24-9-11-12(17)3-2-4-13(11)18/h2-4,7-8H,6,9H2,1H3,(H2,20,21) |
| InChIKey | WEJVMJGROCKCMX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|