C24H24Cl2N4O2 — CID 10004959
[4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 10004959) has the molecular formula C24H24Cl2N4O2 and a molecular weight of 471.39 g/mol. Its IUPAC name is [4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 10004959 |
| Molecular Formula | C24H24Cl2N4O2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | [4-[6-amino-5-[(2,6-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(-c3cnc(N)c(OCc4c(Cl)cccc4Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C24H24Cl2N4O2/c1-29-9-11-30(12-10-29)24(31)17-7-5-16(6-8-17)18-13-22(23(27)28-14-18)32-15-19-20(25)3-2-4-21(19)26/h2-8,13-14H,9-12,15H2,1H3,(H2,27,28) |
| InChIKey | DBHGHGBVQVADRC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|