C23H22ClFN4O2 — CID 58886220
[4-[6-amino-5-[(2-chloro-6-fluorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S)-3-aminopyrrolidin-1-yl]methanone (PubChem CID 58886220) has the molecular formula C23H22ClFN4O2 and a molecular weight of 440.91 g/mol. Its IUPAC name is [4-[6-amino-5-[(2-chloro-6-fluorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S)-3-aminopyrrolidin-1-yl]methanone.
| Compound Name | [4-[6-amino-5-[(2-chloro-6-fluorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S)-3-aminopyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 58886220 |
| Molecular Formula | C23H22ClFN4O2 |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [4-[6-amino-5-[(2-chloro-6-fluorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S)-3-aminopyrrolidin-1-yl]methanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CC[C@H](N)C3)cc2)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H22ClFN4O2/c24-19-2-1-3-20(25)18(19)13-31-21-10-16(11-28-22(21)27)14-4-6-15(7-5-14)23(30)29-9-8-17(26)12-29/h1-7,10-11,17H,8-9,12-13,26H2,(H2,27,28)/t17-/m0/s1 |
| InChIKey | HKTCVSAVQLQBRP-KRWDZBQOSA-N |
| XLogP | 3.88 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|