C25H26Cl2N4O2 — CID 21111228
[4-[6-amino-5-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methanone (PubChem CID 21111228) has the molecular formula C25H26Cl2N4O2 and a molecular weight of 485.42 g/mol. Its IUPAC name is [4-[6-amino-5-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methanone.
| Compound Name | [4-[6-amino-5-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 21111228 |
| Molecular Formula | C25H26Cl2N4O2 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [4-[6-amino-5-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methanone |
| SMILES | CN(C)[C@H]1CCN(C(=O)c2ccc(-c3cnc(N)c(OCc4ccc(Cl)cc4Cl)c3)cc2)C1 |
| InChI | InChI=1S/C25H26Cl2N4O2/c1-30(2)21-9-10-31(14-21)25(32)17-5-3-16(4-6-17)19-11-23(24(28)29-13-19)33-15-18-7-8-20(26)12-22(18)27/h3-8,11-13,21H,9-10,14-15H2,1-2H3,(H2,28,29)/t21-/m0/s1 |
| InChIKey | YVIYTPUPRWRKDJ-NRFANRHFSA-N |
| XLogP | 4.99 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|