C28H30F2N4O2 — CID 58885783
[4-[6-amino-5-[(3,4-difluorophenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 58885783) has the molecular formula C28H30F2N4O2 and a molecular weight of 492.57 g/mol. Its IUPAC name is [4-[6-amino-5-[(3,4-difluorophenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[(3,4-difluorophenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 58885783 |
| Molecular Formula | C28H30F2N4O2 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | [4-[6-amino-5-[(3,4-difluorophenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CCC(N4CCCC4)CC3)cc2)cc1OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C28H30F2N4O2/c29-24-8-3-19(15-25(24)30)18-36-26-16-22(17-32-27(26)31)20-4-6-21(7-5-20)28(35)34-13-9-23(10-14-34)33-11-1-2-12-33/h3-8,15-17,23H,1-2,9-14,18H2,(H2,31,32) |
| InChIKey | XFKVJDNDJUKHAD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|