C25H29N5O2S — CID 58885873
[4-[6-amino-5-(1,3-thiazol-4-ylmethoxy)-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 58885873) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is [4-[6-amino-5-(1,3-thiazol-4-ylmethoxy)-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-(1,3-thiazol-4-ylmethoxy)-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 58885873 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [4-[6-amino-5-(1,3-thiazol-4-ylmethoxy)-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CCC(N4CCCC4)CC3)cc2)cc1OCc1cscn1 |
| InChI | InChI=1S/C25H29N5O2S/c26-24-23(32-15-21-16-33-17-28-21)13-20(14-27-24)18-3-5-19(6-4-18)25(31)30-11-7-22(8-12-30)29-9-1-2-10-29/h3-6,13-14,16-17,22H,1-2,7-12,15H2,(H2,26,27) |
| InChIKey | JUAOUOAHCOGXET-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|