C29H33FN4O2 — CID 58885923
[4-[6-amino-5-[(4-fluoro-3-methylphenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 58885923) has the molecular formula C29H33FN4O2 and a molecular weight of 488.61 g/mol. Its IUPAC name is [4-[6-amino-5-[(4-fluoro-3-methylphenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[(4-fluoro-3-methylphenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 58885923 |
| Molecular Formula | C29H33FN4O2 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [4-[6-amino-5-[(4-fluoro-3-methylphenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | Cc1cc(COc2cc(-c3ccc(C(=O)N4CCC(N5CCCC5)CC4)cc3)cnc2N)ccc1F |
| InChI | InChI=1S/C29H33FN4O2/c1-20-16-21(4-9-26(20)30)19-36-27-17-24(18-32-28(27)31)22-5-7-23(8-6-22)29(35)34-14-10-25(11-15-34)33-12-2-3-13-33/h4-9,16-18,25H,2-3,10-15,19H2,1H3,(H2,31,32) |
| InChIKey | UOJKTXGFYMSEJJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|