C28H31BrN4O2 — CID 58886491
[4-[6-amino-5-[(3-bromophenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 58886491) has the molecular formula C28H31BrN4O2 and a molecular weight of 535.49 g/mol. Its IUPAC name is [4-[6-amino-5-[(3-bromophenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[(3-bromophenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 58886491 |
| Molecular Formula | C28H31BrN4O2 |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | [4-[6-amino-5-[(3-bromophenyl)methoxy]-3-pyridinyl]phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CCC(N4CCCC4)CC3)cc2)cc1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C28H31BrN4O2/c29-24-5-3-4-20(16-24)19-35-26-17-23(18-31-27(26)30)21-6-8-22(9-7-21)28(34)33-14-10-25(11-15-33)32-12-1-2-13-32/h3-9,16-18,25H,1-2,10-15,19H2,(H2,30,31) |
| InChIKey | PUHSNZGYZXVHPD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|