C23H22Cl2N4O2 — CID 21111227
[4-[6-amino-5-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-(3-aminopyrrolidin-1-yl)methanone (PubChem CID 21111227) has the molecular formula C23H22Cl2N4O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is [4-[6-amino-5-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-(3-aminopyrrolidin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-(3-aminopyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 21111227 |
| Molecular Formula | C23H22Cl2N4O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | [4-[6-amino-5-[(2,4-dichlorophenyl)methoxy]-3-pyridinyl]phenyl]-(3-aminopyrrolidin-1-yl)methanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CCC(N)C3)cc2)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N4O2/c24-18-6-5-16(20(25)10-18)13-31-21-9-17(11-28-22(21)27)14-1-3-15(4-2-14)23(30)29-8-7-19(26)12-29/h1-6,9-11,19H,7-8,12-13,26H2,(H2,27,28) |
| InChIKey | SAAQACPSXHLUOV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|