C25H25Cl2FN4O2 — CID 91247830
2-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-1-(3-aminopyrrolidin-1-yl)ethanone (PubChem CID 91247830) has the molecular formula C25H25Cl2FN4O2 and a molecular weight of 503.41 g/mol. Its IUPAC name is 2-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-1-(3-aminopyrrolidin-1-yl)ethanone.
| Compound Name | 2-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-1-(3-aminopyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 91247830 |
| Molecular Formula | C25H25Cl2FN4O2 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 2-[4-[6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-1-(3-aminopyrrolidin-1-yl)ethanone |
| SMILES | Nc1ncc(-c2ccc(CC(=O)N3CCC(N)C3)cc2)cc1OCCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C25H25Cl2FN4O2/c26-20-5-6-21(28)24(27)19(20)8-10-34-22-12-17(13-31-25(22)30)16-3-1-15(2-4-16)11-23(33)32-9-7-18(29)14-32/h1-6,12-13,18H,7-11,14,29H2,(H2,30,31) |
| InChIKey | FYTDGCPJQDILRE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|