C26H27ClF2N4O2 — CID 91263211
[4-[6-amino-5-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 91263211) has the molecular formula C26H27ClF2N4O2 and a molecular weight of 500.98 g/mol. Its IUPAC name is [4-[6-amino-5-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 91263211 |
| Molecular Formula | C26H27ClF2N4O2 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [4-[6-amino-5-[2-(2-chloro-3,6-difluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2ccc(-c3cnc(N)c(OCCc4c(F)ccc(F)c4Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C26H27ClF2N4O2/c1-2-32-10-12-33(13-11-32)26(34)18-5-3-17(4-6-18)19-15-23(25(30)31-16-19)35-14-9-20-21(28)7-8-22(29)24(20)27/h3-8,15-16H,2,9-14H2,1H3,(H2,30,31) |
| InChIKey | RUZHRJSQOBRACB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|