C28H27Cl2FN4O2 — CID 58886212
[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(4-but-3-ynylpiperazin-1-yl)methanone (PubChem CID 58886212) has the molecular formula C28H27Cl2FN4O2 and a molecular weight of 541.45 g/mol. Its IUPAC name is [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(4-but-3-ynylpiperazin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(4-but-3-ynylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 58886212 |
| Molecular Formula | C28H27Cl2FN4O2 |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(4-but-3-ynylpiperazin-1-yl)methanone |
| SMILES | C#CCCN1CCN(C(=O)c2ccc(-c3cnc(N)c(OC(C)c4c(Cl)ccc(F)c4Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C28H27Cl2FN4O2/c1-3-4-11-34-12-14-35(15-13-34)28(36)20-7-5-19(6-8-20)21-16-24(27(32)33-17-21)37-18(2)25-22(29)9-10-23(31)26(25)30/h1,5-10,16-18H,4,11-15H2,2H3,(H2,32,33) |
| InChIKey | QHSMKEYWTBQSGS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|