C25H24Cl2FN3O3 — CID 58885884
[4-[6-amino-5-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-[(3S)-3-hydroxypiperidin-1-yl]methanone (PubChem CID 58885884) has the molecular formula C25H24Cl2FN3O3 and a molecular weight of 504.39 g/mol. Its IUPAC name is [4-[6-amino-5-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-[(3S)-3-hydroxypiperidin-1-yl]methanone.
| Compound Name | [4-[6-amino-5-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-[(3S)-3-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58885884 |
| Molecular Formula | C25H24Cl2FN3O3 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | [4-[6-amino-5-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-[(3S)-3-hydroxypiperidin-1-yl]methanone |
| SMILES | C[C@H](Oc1cc(-c2ccc(C(=O)N3CCC[C@H](O)C3)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C25H24Cl2FN3O3/c1-14(22-19(26)8-9-20(28)23(22)27)34-21-11-17(12-30-24(21)29)15-4-6-16(7-5-15)25(33)31-10-2-3-18(32)13-31/h4-9,11-12,14,18,32H,2-3,10,13H2,1H3,(H2,29,30)/t14-,18-/m0/s1 |
| InChIKey | BOLKWIPZOOSCRV-KSSFIOAISA-N |
| XLogP | 5.51 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|