C27H28Cl2FN3O2 — CID 142938101
[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxymethyl]-3-pyridinyl]phenyl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 142938101) has the molecular formula C27H28Cl2FN3O2 and a molecular weight of 516.44 g/mol. Its IUPAC name is [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxymethyl]-3-pyridinyl]phenyl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxymethyl]-3-pyridinyl]phenyl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 142938101 |
| Molecular Formula | C27H28Cl2FN3O2 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxymethyl]-3-pyridinyl]phenyl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2ccc(-c3cnc(N)c(COC(C)c4c(Cl)ccc(F)c4Cl)c3)cc2)C1 |
| InChI | InChI=1S/C27H28Cl2FN3O2/c1-16-4-3-11-33(14-16)27(34)19-7-5-18(6-8-19)20-12-21(26(31)32-13-20)15-35-17(2)24-22(28)9-10-23(30)25(24)29/h5-10,12-13,16-17H,3-4,11,14-15H2,1-2H3,(H2,31,32) |
| InChIKey | PINWSLFMBPVBMA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|