C25H26Cl2FN3O2 — CID 71231887
[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(3-methylpyrrolidin-1-yl)methanol (PubChem CID 71231887) has the molecular formula C25H26Cl2FN3O2 and a molecular weight of 490.41 g/mol. Its IUPAC name is [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(3-methylpyrrolidin-1-yl)methanol.
| Compound Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(3-methylpyrrolidin-1-yl)methanol |
|---|---|
| PubChem CID | 71231887 |
| Molecular Formula | C25H26Cl2FN3O2 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]-(3-methylpyrrolidin-1-yl)methanol |
| SMILES | CC1CCN(C(O)c2ccc(-c3cnc(N)c(OC(C)c4c(Cl)ccc(F)c4Cl)c3)cc2)C1 |
| InChI | InChI=1S/C25H26Cl2FN3O2/c1-14-9-10-31(13-14)25(32)17-5-3-16(4-6-17)18-11-21(24(29)30-12-18)33-15(2)22-19(26)7-8-20(28)23(22)27/h3-8,11-12,14-15,25,32H,9-10,13H2,1-2H3,(H2,29,30) |
| InChIKey | FXTHRTRSKRLTNY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|