C21H20Cl2FN3O — CID 21110793
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-(dimethylamino)phenyl]pyridin-2-amine (PubChem CID 21110793) has the molecular formula C21H20Cl2FN3O and a molecular weight of 420.32 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-(dimethylamino)phenyl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-(dimethylamino)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 21110793 |
| Molecular Formula | C21H20Cl2FN3O |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-(dimethylamino)phenyl]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2ccc(N(C)C)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H20Cl2FN3O/c1-12(19-16(22)8-9-17(24)20(19)23)28-18-10-14(11-26-21(18)25)13-4-6-15(7-5-13)27(2)3/h4-12H,1-3H3,(H2,25,26) |
| InChIKey | MSCKWFZVEIWVEY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|