C22H22Cl2FN5O — CID 58688109
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(6-piperazin-1-yl-3-pyridinyl)pyridin-2-amine (PubChem CID 58688109) has the molecular formula C22H22Cl2FN5O and a molecular weight of 462.36 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(6-piperazin-1-yl-3-pyridinyl)pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(6-piperazin-1-yl-3-pyridinyl)pyridin-2-amine |
|---|---|
| PubChem CID | 58688109 |
| Molecular Formula | C22H22Cl2FN5O |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(6-piperazin-1-yl-3-pyridinyl)pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2ccc(N3CCNCC3)nc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H22Cl2FN5O/c1-13(20-16(23)3-4-17(25)21(20)24)31-18-10-15(12-29-22(18)26)14-2-5-19(28-11-14)30-8-6-27-7-9-30/h2-5,10-13,27H,6-9H2,1H3,(H2,26,29) |
| InChIKey | OFNHIFCNUMVFNU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|