C17H15Cl2FN4O — CID 54579007
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylimidazol-4-yl)pyridin-2-amine (PubChem CID 54579007) has the molecular formula C17H15Cl2FN4O and a molecular weight of 381.24 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylimidazol-4-yl)pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylimidazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 54579007 |
| Molecular Formula | C17H15Cl2FN4O |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylimidazol-4-yl)pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cn(C)cn2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C17H15Cl2FN4O/c1-9(15-11(18)3-4-12(20)16(15)19)25-14-5-10(6-22-17(14)21)13-7-24(2)8-23-13/h3-9H,1-2H3,(H2,21,22) |
| InChIKey | WLWMSFIVIJARDB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|