About 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine (PubChem CID 11633681) has the molecular formula C17H15Cl2FN4O3S
and a molecular weight of 445.30 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine |
| PubChem CID | 11633681 |
| Molecular Formula | C17H15Cl2FN4O3S |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnn(S(C)(=O)=O)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C17H15Cl2FN4O3S/c1-9(15-12(18)3-4-13(20)16(15)19)27-14-5-10(6-22-17(14)21)11-7-23-24(8-11)28(2,25)26/h3-9H,1-2H3,(H2,21,22) |
| InChIKey | KHLUSSWRALKQNQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine?
The IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine (CID 11633681) is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine.
What is the SMILES notation for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine?
The canonical SMILES for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine is CC(Oc1cc(-c2cnn(S(C)(=O)=O)c2)cnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine?
The InChIKey is KHLUSSWRALKQNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2FN4O3S/c1-9(15-12(18)3-4-13(20)16(15)19)27-14-5-10(6-22-17(14)21)11-7-23-24(8-11)28(2,25)26/h3-9H,1-2H3,(H2,21,22).
What are the key properties of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine?
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine has a molecular weight of 445.30 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-methylsulfonylpyrazol-4-yl)pyridin-2-amine is sourced from PubChem (CID 11633681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).