C23H25Cl2FN4O — CID 58659156
5-[1-(2-cyclopentylethyl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 58659156) has the molecular formula C23H25Cl2FN4O and a molecular weight of 463.38 g/mol. Its IUPAC name is 5-[1-(2-cyclopentylethyl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 5-[1-(2-cyclopentylethyl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 58659156 |
| Molecular Formula | C23H25Cl2FN4O |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 5-[1-(2-cyclopentylethyl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnn(CCC3CCCC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H25Cl2FN4O/c1-14(21-18(24)6-7-19(26)22(21)25)31-20-10-16(11-28-23(20)27)17-12-29-30(13-17)9-8-15-4-2-3-5-15/h6-7,10-15H,2-5,8-9H2,1H3,(H2,27,28) |
| InChIKey | QMQDHIYJTYMBAX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|