C21H20Cl2F3N5O — CID 71728094
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-[(3R,5R)-3,5-difluoropiperidin-4-yl]pyrazol-4-yl]pyridin-2-amine (PubChem CID 71728094) has the molecular formula C21H20Cl2F3N5O and a molecular weight of 486.33 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-[(3R,5R)-3,5-difluoropiperidin-4-yl]pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-[(3R,5R)-3,5-difluoropiperidin-4-yl]pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 71728094 |
| Molecular Formula | C21H20Cl2F3N5O |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-[(3R,5R)-3,5-difluoropiperidin-4-yl]pyrazol-4-yl]pyridin-2-amine |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3[C@H](F)CNC[C@H]3F)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H20Cl2F3N5O/c1-10(18-13(22)2-3-14(24)19(18)23)32-17-4-11(5-29-21(17)27)12-6-30-31(9-12)20-15(25)7-28-8-16(20)26/h2-6,9-10,15-16,20,28H,7-8H2,1H3,(H2,27,29)/t10-,15-,16-/m1/s1 |
| InChIKey | TUJNYXGJMPGFNF-UHNFBRDESA-N |
| XLogP | 4.93 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|