C21H19Cl2F4N5O — CID 78161059
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(3,3,5-trifluoropiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 78161059) has the molecular formula C21H19Cl2F4N5O and a molecular weight of 504.32 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(3,3,5-trifluoropiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(3,3,5-trifluoropiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 78161059 |
| Molecular Formula | C21H19Cl2F4N5O |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(3,3,5-trifluoropiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnn(C3C(F)CNCC3(F)F)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H19Cl2F4N5O/c1-10(17-13(22)2-3-14(24)18(17)23)33-16-4-11(5-30-20(16)28)12-6-31-32(8-12)19-15(25)7-29-9-21(19,26)27/h2-6,8,10,15,19,29H,7,9H2,1H3,(H2,28,30) |
| InChIKey | OXXFAAGGLKEDAX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|