C21H21Cl2F2N5O — CID 78160907
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(3-fluoropiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 78160907) has the molecular formula C21H21Cl2F2N5O and a molecular weight of 468.34 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(3-fluoropiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(3-fluoropiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 78160907 |
| Molecular Formula | C21H21Cl2F2N5O |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(3-fluoropiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnn(C3CCNCC3F)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H21Cl2F2N5O/c1-11(19-14(22)2-3-15(24)20(19)23)31-18-6-12(7-28-21(18)26)13-8-29-30(10-13)17-4-5-27-9-16(17)25/h2-3,6-8,10-11,16-17,27H,4-5,9H2,1H3,(H2,26,28) |
| InChIKey | BKLRFQFMWXJQHQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|