C22H21Cl2FN4O3 — CID 78160439
5-[1-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine (PubChem CID 78160439) has the molecular formula C22H21Cl2FN4O3 and a molecular weight of 479.34 g/mol. Its IUPAC name is 5-[1-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine.
| Compound Name | 5-[1-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 78160439 |
| Molecular Formula | C22H21Cl2FN4O3 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 5-[1-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnn(C3COC4CCOC43)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H21Cl2FN4O3/c1-11(19-14(23)2-3-15(25)20(19)24)32-18-6-12(7-27-22(18)26)13-8-28-29(9-13)16-10-31-17-4-5-30-21(16)17/h2-3,6-9,11,16-17,21H,4-5,10H2,1H3,(H2,26,27) |
| InChIKey | SCLFKTMSMAHTPT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|