C23H30Cl2FN5O — CID 143190162
5-[1-(azetidin-3-yl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine;ethane (PubChem CID 143190162) has the molecular formula C23H30Cl2FN5O and a molecular weight of 482.43 g/mol. Its IUPAC name is 5-[1-(azetidin-3-yl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine;ethane.
| Compound Name | 5-[1-(azetidin-3-yl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 143190162 |
| Molecular Formula | C23H30Cl2FN5O |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 5-[1-(azetidin-3-yl)pyrazol-4-yl]-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridin-2-amine;ethane |
| SMILES | CC.CC.CC(Oc1cc(-c2cnn(C3CNC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H18Cl2FN5O.2C2H6/c1-10(17-14(20)2-3-15(22)18(17)21)28-16-4-11(5-25-19(16)23)12-6-26-27(9-12)13-7-24-8-13;2*1-2/h2-6,9-10,13,24H,7-8H2,1H3,(H2,23,25);2*1-2H3 |
| InChIKey | NIPKIQUTPWCXNE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|