C22H21Cl2FN4O2 — CID 78168555
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-oxaspiro[2.4]heptan-6-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 78168555) has the molecular formula C22H21Cl2FN4O2 and a molecular weight of 463.34 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-oxaspiro[2.4]heptan-6-yl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-oxaspiro[2.4]heptan-6-yl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 78168555 |
| Molecular Formula | C22H21Cl2FN4O2 |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-oxaspiro[2.4]heptan-6-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnn(C3COC4(CC4)C3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H21Cl2FN4O2/c1-12(19-16(23)2-3-17(25)20(19)24)31-18-6-13(8-27-21(18)26)14-9-28-29(10-14)15-7-22(4-5-22)30-11-15/h2-3,6,8-10,12,15H,4-5,7,11H2,1H3,(H2,26,27) |
| InChIKey | OXHOZAZJYGQZEU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|