C23H23Cl2FN4O2 — CID 71748160
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(5-oxaspiro[3.4]octan-7-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 71748160) has the molecular formula C23H23Cl2FN4O2 and a molecular weight of 477.37 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(5-oxaspiro[3.4]octan-7-yl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(5-oxaspiro[3.4]octan-7-yl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 71748160 |
| Molecular Formula | C23H23Cl2FN4O2 |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(5-oxaspiro[3.4]octan-7-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3COC4(CCC4)C3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H23Cl2FN4O2/c1-13(20-17(24)3-4-18(26)21(20)25)32-19-7-14(9-28-22(19)27)15-10-29-30(11-15)16-8-23(31-12-16)5-2-6-23/h3-4,7,9-11,13,16H,2,5-6,8,12H2,1H3,(H2,27,28)/t13-,16?/m1/s1 |
| InChIKey | QFZODEYYKUIXOL-JBZHPUCOSA-N |
| XLogP | 6.00 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|