C27H38Cl2FN5O — CID 155591061
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine;ethane;propane (PubChem CID 155591061) has the molecular formula C27H38Cl2FN5O and a molecular weight of 538.54 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine;ethane;propane.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine;ethane;propane |
|---|---|
| PubChem CID | 155591061 |
| Molecular Formula | C27H38Cl2FN5O |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine;ethane;propane |
| SMILES | CC.CCC.C[C@@H](Oc1cc(-c2cnn(C3CCN(C)CC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H24Cl2FN5O.C3H8.C2H6/c1-13(20-17(23)3-4-18(25)21(20)24)31-19-9-14(10-27-22(19)26)15-11-28-30(12-15)16-5-7-29(2)8-6-16;1-3-2;1-2/h3-4,9-13,16H,5-8H2,1-2H3,(H2,26,27);3H2,1-2H3;1-2H3/t13-;;/m1../s1 |
| InChIKey | HJNUWPRHUKNMBO-FFXKMJQXSA-N |
| XLogP | 7.82 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|