C27H32Cl2FN5O5 — CID 134450917
1-[4-[4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]-2-[2-(2-hydroxyethoxy)ethoxy]ethanone (PubChem CID 134450917) has the molecular formula C27H32Cl2FN5O5 and a molecular weight of 596.49 g/mol. Its IUPAC name is 1-[4-[4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]-2-[2-(2-hydroxyethoxy)ethoxy]ethanone.
| Compound Name | 1-[4-[4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]-2-[2-(2-hydroxyethoxy)ethoxy]ethanone |
|---|---|
| PubChem CID | 134450917 |
| Molecular Formula | C27H32Cl2FN5O5 |
| Molecular Weight | 596.49 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | 1-[4-[4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]-2-[2-(2-hydroxyethoxy)ethoxy]ethanone |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3CCN(C(=O)COCCOCCO)CC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C27H32Cl2FN5O5/c1-17(25-21(28)2-3-22(30)26(25)29)40-23-12-18(13-32-27(23)31)19-14-33-35(15-19)20-4-6-34(7-5-20)24(37)16-39-11-10-38-9-8-36/h2-3,12-15,17,20,36H,4-11,16H2,1H3,(H2,31,32)/t17-/m1/s1 |
| InChIKey | DEPXJNWWNNBGDA-QGZVFWFLSA-N |
| XLogP | 4.30 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|