C26H32Cl2FN5O — CID 72944398
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(1-pentylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 72944398) has the molecular formula C26H32Cl2FN5O and a molecular weight of 520.48 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(1-pentylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(1-pentylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 72944398 |
| Molecular Formula | C26H32Cl2FN5O |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(1-pentylpiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | CCCCCN1CCC(n2cc(-c3cnc(N)c(O[C@H](C)c4c(Cl)ccc(F)c4Cl)c3)cn2)CC1 |
| InChI | InChI=1S/C26H32Cl2FN5O/c1-3-4-5-10-33-11-8-20(9-12-33)34-16-19(15-32-34)18-13-23(26(30)31-14-18)35-17(2)24-21(27)6-7-22(29)25(24)28/h6-7,13-17,20H,3-5,8-12H2,1-2H3,(H2,30,31)/t17-/m1/s1 |
| InChIKey | LZOCRBNOASFVSE-QGZVFWFLSA-N |
| XLogP | 6.94 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|