C23H27Cl2FN6O3S — CID 86270489
2-[4-[4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]ethanesulfonamide (PubChem CID 86270489) has the molecular formula C23H27Cl2FN6O3S and a molecular weight of 557.48 g/mol. Its IUPAC name is 2-[4-[4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]ethanesulfonamide.
| Compound Name | 2-[4-[4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 86270489 |
| Molecular Formula | C23H27Cl2FN6O3S |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-[4-[4-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]ethanesulfonamide |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3CCN(CCS(N)(=O)=O)CC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H27Cl2FN6O3S/c1-14(21-18(24)2-3-19(26)22(21)25)35-20-10-15(11-29-23(20)27)16-12-30-32(13-16)17-4-6-31(7-5-17)8-9-36(28,33)34/h2-3,10-14,17H,4-9H2,1H3,(H2,27,29)(H2,28,33,34)/t14-/m1/s1 |
| InChIKey | ATTBVULSEIYDBN-CQSZACIVSA-N |
| XLogP | 4.04 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|