C21H22Cl2FN5O — CID 72704433
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(2,2,3,3,4,5,5-heptadeuteriopiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 72704433) has the molecular formula C21H22Cl2FN5O and a molecular weight of 457.39 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(2,2,3,3,4,5,5-heptadeuteriopiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(2,2,3,3,4,5,5-heptadeuteriopiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 72704433 |
| Molecular Formula | C21H22Cl2FN5O |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(2,2,3,3,4,5,5-heptadeuteriopiperidin-4-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | [2H]C1([2H])CNC([2H])([2H])C([2H])([2H])C1([2H])n1cc(-c2cnc(N)c(O[C@H](C)c3c(Cl)ccc(F)c3Cl)c2)cn1 |
| InChI | InChI=1S/C21H22Cl2FN5O/c1-12(19-16(22)2-3-17(24)20(19)23)30-18-8-13(9-27-21(18)25)14-10-28-29(11-14)15-4-6-26-7-5-15/h2-3,8-12,15,26H,4-7H2,1H3,(H2,25,27)/t12-/m1/s1/i4D2,5D2,6D2,15D/t12-,15? |
| InChIKey | KTEIFNKAUNYNJU-PZTWVOGPSA-N |
| XLogP | 5.04 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|