C22H25Cl2FN4O3 — CID 143190054
2-[[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]methyl]butanoic acid;methane (PubChem CID 143190054) has the molecular formula C22H25Cl2FN4O3 and a molecular weight of 483.37 g/mol. Its IUPAC name is 2-[[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]methyl]butanoic acid;methane.
| Compound Name | 2-[[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]methyl]butanoic acid;methane |
|---|---|
| PubChem CID | 143190054 |
| Molecular Formula | C22H25Cl2FN4O3 |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 2-[[4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]methyl]butanoic acid;methane |
| SMILES | C.CCC(Cn1cc(-c2cnc(N)c(OC(C)c3c(Cl)ccc(F)c3Cl)c2)cn1)C(=O)O |
| InChI | InChI=1S/C21H21Cl2FN4O3.CH4/c1-3-12(21(29)30)9-28-10-14(8-27-28)13-6-17(20(25)26-7-13)31-11(2)18-15(22)4-5-16(24)19(18)23;/h4-8,10-12H,3,9H2,1-2H3,(H2,25,26)(H,29,30);1H4 |
| InChIKey | ICWQKJSQXOSMMV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|