C22H20Cl2FN3O2 — CID 58885740
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-ethylbenzamide (PubChem CID 58885740) has the molecular formula C22H20Cl2FN3O2 and a molecular weight of 448.33 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-ethylbenzamide.
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 58885740 |
| Molecular Formula | C22H20Cl2FN3O2 |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(-c2cnc(N)c(OC(C)c3c(Cl)ccc(F)c3Cl)c2)cc1 |
| InChI | InChI=1S/C22H20Cl2FN3O2/c1-3-27-22(29)14-6-4-13(5-7-14)15-10-18(21(26)28-11-15)30-12(2)19-16(23)8-9-17(25)20(19)24/h4-12H,3H2,1-2H3,(H2,26,28)(H,27,29) |
| InChIKey | BVEGQMUAJLMQBP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|