C28H21Cl2F4N3O3 — CID 58885734
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 58885734) has the molecular formula C28H21Cl2F4N3O3 and a molecular weight of 594.39 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 58885734 |
| Molecular Formula | C28H21Cl2F4N3O3 |
| Molecular Weight | 594.39 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | CC(Oc1cc(-c2ccc(C(=O)NCc3ccc(OC(F)(F)F)cc3)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C28H21Cl2F4N3O3/c1-15(24-21(29)10-11-22(31)25(24)30)39-23-12-19(14-36-26(23)35)17-4-6-18(7-5-17)27(38)37-13-16-2-8-20(9-3-16)40-28(32,33)34/h2-12,14-15H,13H2,1H3,(H2,35,36)(H,37,38) |
| InChIKey | WUVHHCGNELFIOG-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.39 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|