C20H17Cl2FN2O2 — CID 21110829
[3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]methanol (PubChem CID 21110829) has the molecular formula C20H17Cl2FN2O2 and a molecular weight of 407.27 g/mol. Its IUPAC name is [3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]methanol.
| Compound Name | [3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]methanol |
|---|---|
| PubChem CID | 21110829 |
| Molecular Formula | C20H17Cl2FN2O2 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | [3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]phenyl]methanol |
| SMILES | CC(Oc1cc(-c2cccc(CO)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H17Cl2FN2O2/c1-11(18-15(21)5-6-16(23)19(18)22)27-17-8-14(9-25-20(17)24)13-4-2-3-12(7-13)10-26/h2-9,11,26H,10H2,1H3,(H2,24,25) |
| InChIKey | FQNFURORIUWZRG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|