C28H24Cl2FN3O4 — CID 58886449
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]benzamide (PubChem CID 58886449) has the molecular formula C28H24Cl2FN3O4 and a molecular weight of 556.42 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58886449 |
| Molecular Formula | C28H24Cl2FN3O4 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(-c3cnc(N)c(OC(C)c4c(Cl)ccc(F)c4Cl)c3)cc2)ccc1O |
| InChI | InChI=1S/C28H24Cl2FN3O4/c1-15(25-20(29)8-9-21(31)26(25)30)38-24-12-19(14-33-27(24)32)17-4-6-18(7-5-17)28(36)34-13-16-3-10-22(35)23(11-16)37-2/h3-12,14-15,35H,13H2,1-2H3,(H2,32,33)(H,34,36) |
| InChIKey | KNFHBRJREPOIFQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|