C23H21Cl2FN4O2 — CID 21110873
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-(azetidin-3-yl)benzamide (PubChem CID 21110873) has the molecular formula C23H21Cl2FN4O2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-(azetidin-3-yl)benzamide.
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-(azetidin-3-yl)benzamide |
|---|---|
| PubChem CID | 21110873 |
| Molecular Formula | C23H21Cl2FN4O2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-(azetidin-3-yl)benzamide |
| SMILES | CC(Oc1cc(-c2ccc(C(=O)NC3CNC3)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H21Cl2FN4O2/c1-12(20-17(24)6-7-18(26)21(20)25)32-19-8-15(9-29-22(19)27)13-2-4-14(5-3-13)23(31)30-16-10-28-11-16/h2-9,12,16,28H,10-11H2,1H3,(H2,27,29)(H,30,31) |
| InChIKey | GWJYZRVAOMEGQV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|