C27H28Cl2FN3O3 — CID 58837240
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[4-(hydroxymethyl)cyclohexyl]benzamide (PubChem CID 58837240) has the molecular formula C27H28Cl2FN3O3 and a molecular weight of 532.44 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[4-(hydroxymethyl)cyclohexyl]benzamide.
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[4-(hydroxymethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 58837240 |
| Molecular Formula | C27H28Cl2FN3O3 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-N-[4-(hydroxymethyl)cyclohexyl]benzamide |
| SMILES | CC(Oc1cc(-c2ccc(C(=O)NC3CCC(CO)CC3)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C27H28Cl2FN3O3/c1-15(24-21(28)10-11-22(30)25(24)29)36-23-12-19(13-32-26(23)31)17-4-6-18(7-5-17)27(35)33-20-8-2-16(14-34)3-9-20/h4-7,10-13,15-16,20,34H,2-3,8-9,14H2,1H3,(H2,31,32)(H,33,35) |
| InChIKey | KBJUEJDEMPRWAN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|