C24H25Cl2FN4O2 — CID 58688137
[1-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]piperidin-4-yl]methanol (PubChem CID 58688137) has the molecular formula C24H25Cl2FN4O2 and a molecular weight of 491.39 g/mol. Its IUPAC name is [1-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]piperidin-4-yl]methanol.
| Compound Name | [1-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 58688137 |
| Molecular Formula | C24H25Cl2FN4O2 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [1-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]piperidin-4-yl]methanol |
| SMILES | CC(Oc1cc(-c2ccc(N3CCC(CO)CC3)nc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C24H25Cl2FN4O2/c1-14(22-18(25)3-4-19(27)23(22)26)33-20-10-17(12-30-24(20)28)16-2-5-21(29-11-16)31-8-6-15(13-32)7-9-31/h2-5,10-12,14-15,32H,6-9,13H2,1H3,(H2,28,30) |
| InChIKey | TWJSKODEDNMANP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|