C23H23Cl2FN4O — CID 163938106
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(6-piperidin-1-yl-3-pyridinyl)pyridin-2-amine (PubChem CID 163938106) has the molecular formula C23H23Cl2FN4O and a molecular weight of 461.37 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(6-piperidin-1-yl-3-pyridinyl)pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(6-piperidin-1-yl-3-pyridinyl)pyridin-2-amine |
|---|---|
| PubChem CID | 163938106 |
| Molecular Formula | C23H23Cl2FN4O |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(6-piperidin-1-yl-3-pyridinyl)pyridin-2-amine |
| SMILES | C[C@@H](Oc1cc(-c2ccc(N3CCCCC3)nc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H23Cl2FN4O/c1-14(21-17(24)6-7-18(26)22(21)25)31-19-11-16(13-29-23(19)27)15-5-8-20(28-12-15)30-9-3-2-4-10-30/h5-8,11-14H,2-4,9-10H2,1H3,(H2,27,29)/t14-/m1/s1 |
| InChIKey | ROOUAKFCHMXPCE-CQSZACIVSA-N |
| XLogP | 6.30 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|