C26H28Cl2FN3O2 — CID 142774225
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-(1-ethylpiperidin-4-yl)oxyphenyl]pyridin-2-amine (PubChem CID 142774225) has the molecular formula C26H28Cl2FN3O2 and a molecular weight of 504.43 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-(1-ethylpiperidin-4-yl)oxyphenyl]pyridin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-(1-ethylpiperidin-4-yl)oxyphenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 142774225 |
| Molecular Formula | C26H28Cl2FN3O2 |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-(1-ethylpiperidin-4-yl)oxyphenyl]pyridin-2-amine |
| SMILES | CCN1CCC(Oc2ccc(-c3cnc(N)c(OC(C)c4c(Cl)ccc(F)c4Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C26H28Cl2FN3O2/c1-3-32-12-10-20(11-13-32)34-19-6-4-17(5-7-19)18-14-23(26(30)31-15-18)33-16(2)24-21(27)8-9-22(29)25(24)28/h4-9,14-16,20H,3,10-13H2,1-2H3,(H2,30,31) |
| InChIKey | VHQMSUYVLQWPNK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|